C37H52O5 — CID 134193800
2-[2-(3-hydroxypropyl)-5-[4-[4-(5-pentyloxan-2-yl)cyclohexyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134193800) has the molecular formula C37H52O5 and a molecular weight of 576.82 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropyl)-5-[4-[4-(5-pentyloxan-2-yl)cyclohexyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(3-hydroxypropyl)-5-[4-[4-(5-pentyloxan-2-yl)cyclohexyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193800 |
| Molecular Formula | C37H52O5 |
| Molecular Weight | 576.82 g/mol |
| Exact Mass | 576.38 |
| IUPAC Name | 2-[2-(3-hydroxypropyl)-5-[4-[4-(5-pentyloxan-2-yl)cyclohexyl]phenyl]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(-c2ccc(C3CCC(C4CCC(CCCCC)CO4)CC3)cc2)ccc1CCCO |
| InChI | InChI=1S/C37H52O5/c1-4-5-6-8-28-10-21-35(42-26-28)33-17-15-30(16-18-33)29-11-13-31(14-12-29)34-20-19-32(9-7-22-38)36(25-34)40-23-24-41-37(39)27(2)3/h11-14,19-20,25,28,30,33,35,38H,2,4-10,15-18,21-24,26H2,1,3H3 |
| InChIKey | JOJIPCZPZOXCJN-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.82 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|