C23H34O4 — CID 134193059
2-[2-(3-hydroxypropyl)-5-(5-propyloxan-2-yl)phenyl]ethyl 2-methylprop-2-enoate (PubChem CID 134193059) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropyl)-5-(5-propyloxan-2-yl)phenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(3-hydroxypropyl)-5-(5-propyloxan-2-yl)phenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193059 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-[2-(3-hydroxypropyl)-5-(5-propyloxan-2-yl)phenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(C2CCC(CCC)CO2)ccc1CCCO |
| InChI | InChI=1S/C23H34O4/c1-4-6-18-8-11-22(27-16-18)21-10-9-19(7-5-13-24)20(15-21)12-14-26-23(25)17(2)3/h9-10,15,18,22,24H,2,4-8,11-14,16H2,1,3H3 |
| InChIKey | YFBCWQBYPMAGNE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|