C42H48O5 — CID 134193926
2-[2-[6-[4-(3-hydroxypropyl)-3-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]naphthalen-2-yl]-5-pentylphenyl]ethyl 2-methylprop-2-enoate (PubChem CID 134193926) has the molecular formula C42H48O5 and a molecular weight of 632.84 g/mol. Its IUPAC name is 2-[2-[6-[4-(3-hydroxypropyl)-3-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]naphthalen-2-yl]-5-pentylphenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[6-[4-(3-hydroxypropyl)-3-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]naphthalen-2-yl]-5-pentylphenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193926 |
| Molecular Formula | C42H48O5 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | 2-[2-[6-[4-(3-hydroxypropyl)-3-[2-(2-methylprop-2-enoyloxy)ethyl]phenyl]naphthalen-2-yl]-5-pentylphenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(-c2ccc3cc(-c4ccc(CCCCC)cc4CCOC(=O)C(=C)C)ccc3c2)ccc1CCCO |
| InChI | InChI=1S/C42H48O5/c1-6-7-8-10-31-12-19-40(39(25-31)21-24-47-42(45)30(4)5)38-18-17-35-26-34(15-16-36(35)28-38)33-14-13-32(11-9-22-43)37(27-33)20-23-46-41(44)29(2)3/h12-19,25-28,43H,2,4,6-11,20-24H2,1,3,5H3 |
| InChIKey | PPNUBALTXYRSET-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|