C36H46O3 — CID 134193731
2-[2-[2-[3-ethyl-4-[4-(3-hydroxypropyl)phenyl]phenyl]ethyl]-5-pentylphenyl]ethyl 2-methylprop-2-enoate (PubChem CID 134193731) has the molecular formula C36H46O3 and a molecular weight of 526.76 g/mol. Its IUPAC name is 2-[2-[2-[3-ethyl-4-[4-(3-hydroxypropyl)phenyl]phenyl]ethyl]-5-pentylphenyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[3-ethyl-4-[4-(3-hydroxypropyl)phenyl]phenyl]ethyl]-5-pentylphenyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193731 |
| Molecular Formula | C36H46O3 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | 2-[2-[2-[3-ethyl-4-[4-(3-hydroxypropyl)phenyl]phenyl]ethyl]-5-pentylphenyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(CCCCC)ccc1CCc1ccc(-c2ccc(CCCO)cc2)c(CC)c1 |
| InChI | InChI=1S/C36H46O3/c1-5-7-8-10-29-14-17-32(34(26-29)22-24-39-36(38)27(3)4)18-15-30-16-21-35(31(6-2)25-30)33-19-12-28(13-20-33)11-9-23-37/h12-14,16-17,19-21,25-26,37H,3,5-11,15,18,22-24H2,1-2,4H3 |
| InChIKey | KYPAYRMSNRKITK-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|