C32H37FO3 — CID 118699996
3-[4-[2-[4-[2-ethyl-4-(3-hydroxypropyl)phenyl]-3-fluorophenyl]ethyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 118699996) has the molecular formula C32H37FO3 and a molecular weight of 488.64 g/mol. Its IUPAC name is 3-[4-[2-[4-[2-ethyl-4-(3-hydroxypropyl)phenyl]-3-fluorophenyl]ethyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[2-[4-[2-ethyl-4-(3-hydroxypropyl)phenyl]-3-fluorophenyl]ethyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118699996 |
| Molecular Formula | C32H37FO3 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 3-[4-[2-[4-[2-ethyl-4-(3-hydroxypropyl)phenyl]-3-fluorophenyl]ethyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1ccc(CCc2ccc(-c3ccc(CCCO)cc3CC)c(F)c2)cc1 |
| InChI | InChI=1S/C32H37FO3/c1-4-28-21-26(7-5-19-34)15-17-29(28)30-18-16-27(22-31(30)33)14-13-25-11-9-24(10-12-25)8-6-20-36-32(35)23(2)3/h9-12,15-18,21-22,34H,2,4-8,13-14,19-20H2,1,3H3 |
| InChIKey | KHTFQGNKGHJHNH-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|