C29H31FO3 — CID 134193635
[2-[2-fluoro-4-(hydroxymethyl)phenyl]-5-(4-pentylphenyl)phenyl]methyl 2-methylprop-2-enoate (PubChem CID 134193635) has the molecular formula C29H31FO3 and a molecular weight of 446.56 g/mol. Its IUPAC name is [2-[2-fluoro-4-(hydroxymethyl)phenyl]-5-(4-pentylphenyl)phenyl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-[2-fluoro-4-(hydroxymethyl)phenyl]-5-(4-pentylphenyl)phenyl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193635 |
| Molecular Formula | C29H31FO3 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | [2-[2-fluoro-4-(hydroxymethyl)phenyl]-5-(4-pentylphenyl)phenyl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCc1cc(-c2ccc(CCCCC)cc2)ccc1-c1ccc(CO)cc1F |
| InChI | InChI=1S/C29H31FO3/c1-4-5-6-7-21-8-11-23(12-9-21)24-13-15-26(25(17-24)19-33-29(32)20(2)3)27-14-10-22(18-31)16-28(27)30/h8-17,31H,2,4-7,18-19H2,1,3H3 |
| InChIKey | IMDNGYXRVKAGEK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|