C33H35FO3 — CID 134193437
[(E)-3-[5-[2-fluoro-4-(4-pentylphenyl)phenyl]-2-[(E)-3-hydroxyprop-1-enyl]phenyl]prop-2-enyl] 2-methylprop-2-enoate (PubChem CID 134193437) has the molecular formula C33H35FO3 and a molecular weight of 498.64 g/mol. Its IUPAC name is [(E)-3-[5-[2-fluoro-4-(4-pentylphenyl)phenyl]-2-[(E)-3-hydroxyprop-1-enyl]phenyl]prop-2-enyl] 2-methylprop-2-enoate.
| Compound Name | [(E)-3-[5-[2-fluoro-4-(4-pentylphenyl)phenyl]-2-[(E)-3-hydroxyprop-1-enyl]phenyl]prop-2-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193437 |
| Molecular Formula | C33H35FO3 |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [(E)-3-[5-[2-fluoro-4-(4-pentylphenyl)phenyl]-2-[(E)-3-hydroxyprop-1-enyl]phenyl]prop-2-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC/C=C/c1cc(-c2ccc(-c3ccc(CCCCC)cc3)cc2F)ccc1/C=C/CO |
| InChI | InChI=1S/C33H35FO3/c1-4-5-6-9-25-12-14-27(15-13-25)29-18-19-31(32(34)23-29)30-17-16-26(10-7-20-35)28(22-30)11-8-21-37-33(36)24(2)3/h7-8,10-19,22-23,35H,2,4-6,9,20-21H2,1,3H3/b10-7+,11-8+ |
| InChIKey | NKJRDWUKVAJXIE-AMMQDNIMSA-N |
| XLogP | 8.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|