C34H33F3O — CID 139457380
4-[3-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-2-methylidenebutan-1-ol (PubChem CID 139457380) has the molecular formula C34H33F3O and a molecular weight of 514.63 g/mol. Its IUPAC name is 4-[3-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-2-methylidenebutan-1-ol.
| Compound Name | 4-[3-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-2-methylidenebutan-1-ol |
|---|---|
| PubChem CID | 139457380 |
| Molecular Formula | C34H33F3O |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 4-[3-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]-2-methylidenebutan-1-ol |
| SMILES | C=C(CO)CCc1ccc(-c2ccc(-c3ccc(-c4ccc(CCCCC)cc4)cc3F)cc2F)c(F)c1 |
| InChI | InChI=1S/C34H33F3O/c1-3-4-5-6-24-9-12-26(13-10-24)27-14-17-29(33(36)20-27)28-15-18-31(34(37)21-28)30-16-11-25(19-32(30)35)8-7-23(2)22-38/h9-21,38H,2-8,22H2,1H3 |
| InChIKey | LTFNJVQAYBFIAH-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|