C34H32F3NO — CID 134245599
N-[2-[3-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]ethyl]prop-2-enamide (PubChem CID 134245599) has the molecular formula C34H32F3NO and a molecular weight of 527.63 g/mol. Its IUPAC name is N-[2-[3-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]ethyl]prop-2-enamide.
| Compound Name | N-[2-[3-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 134245599 |
| Molecular Formula | C34H32F3NO |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | N-[2-[3-fluoro-4-[2-fluoro-4-[2-fluoro-4-(4-pentylphenyl)phenyl]phenyl]phenyl]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCc1ccc(-c2ccc(-c3ccc(-c4ccc(CCCCC)cc4)cc3F)cc2F)c(F)c1 |
| InChI | InChI=1S/C34H32F3NO/c1-3-5-6-7-23-8-11-25(12-9-23)26-13-16-28(32(36)21-26)27-14-17-30(33(37)22-27)29-15-10-24(20-31(29)35)18-19-38-34(39)4-2/h4,8-17,20-22H,2-3,5-7,18-19H2,1H3,(H,38,39) |
| InChIKey | NXOJDVLGCRGRNR-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|