C31H36FNO3 — CID 134193541
2-[2-(3-aminopropyl)-5-[2-fluoro-4-(4-pentylphenyl)phenyl]phenoxy]ethyl prop-2-enoate (PubChem CID 134193541) has the molecular formula C31H36FNO3 and a molecular weight of 489.63 g/mol. Its IUPAC name is 2-[2-(3-aminopropyl)-5-[2-fluoro-4-(4-pentylphenyl)phenyl]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(3-aminopropyl)-5-[2-fluoro-4-(4-pentylphenyl)phenyl]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 134193541 |
| Molecular Formula | C31H36FNO3 |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | 2-[2-(3-aminopropyl)-5-[2-fluoro-4-(4-pentylphenyl)phenyl]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1cc(-c2ccc(-c3ccc(CCCCC)cc3)cc2F)ccc1CCCN |
| InChI | InChI=1S/C31H36FNO3/c1-3-5-6-8-23-10-12-24(13-11-23)26-16-17-28(29(32)21-26)27-15-14-25(9-7-18-33)30(22-27)35-19-20-36-31(34)4-2/h4,10-17,21-22H,2-3,5-9,18-20,33H2,1H3 |
| InChIKey | PQFHXGFTRXAJJZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|