C27H29FO2 — CID 142331753
propyl 4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzoate (PubChem CID 142331753) has the molecular formula C27H29FO2 and a molecular weight of 404.53 g/mol. Its IUPAC name is propyl 4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzoate.
| Compound Name | propyl 4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzoate |
|---|---|
| PubChem CID | 142331753 |
| Molecular Formula | C27H29FO2 |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | propyl 4-[2-fluoro-4-(4-pentylphenyl)phenyl]benzoate |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(C(=O)OCCC)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C27H29FO2/c1-3-5-6-7-20-8-10-21(11-9-20)24-16-17-25(26(28)19-24)22-12-14-23(15-13-22)27(29)30-18-4-2/h8-17,19H,3-7,18H2,1-2H3 |
| InChIKey | VBOMFGBLTGCDCN-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|