C23H21FO2 — CID 142331656
methyl 4-[2-fluoro-4-(4-propylphenyl)phenyl]benzoate (PubChem CID 142331656) has the molecular formula C23H21FO2 and a molecular weight of 348.42 g/mol. Its IUPAC name is methyl 4-[2-fluoro-4-(4-propylphenyl)phenyl]benzoate.
| Compound Name | methyl 4-[2-fluoro-4-(4-propylphenyl)phenyl]benzoate |
|---|---|
| PubChem CID | 142331656 |
| Molecular Formula | C23H21FO2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | methyl 4-[2-fluoro-4-(4-propylphenyl)phenyl]benzoate |
| SMILES | CCCc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H21FO2/c1-3-4-16-5-7-17(8-6-16)20-13-14-21(22(24)15-20)18-9-11-19(12-10-18)23(25)26-2/h5-15H,3-4H2,1-2H3 |
| InChIKey | BBBPAEMNRIFIEL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |