methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate

C23H20F2O2 — CID 142331543

IUPACmethyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate
SMILESCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)c(F)c2F)cc1
InChIInChI=1S/C23H20F2O2/c1-3-4-15-5-7-16(8-6-15)19-13-14-20(22(25)21(19)24)17-9-11-18(12-10-17)23(26)27-2/h5-14H,3-4H2,1-2H3
InChIKeyDJRVJEJGNSKXDB-UHFFFAOYSA-N
MW366.41 g/mol
LogP6.04
Rot. Bonds5

About methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate

methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate (PubChem CID 142331543) has the molecular formula C23H20F2O2 and a molecular weight of 366.41 g/mol. Its IUPAC name is methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate
PubChem CID142331543
Molecular FormulaC23H20F2O2
Molecular Weight366.41 g/mol
Exact Mass366.14
IUPAC Namemethyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate
SMILESCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)c(F)c2F)cc1
InChIInChI=1S/C23H20F2O2/c1-3-4-15-5-7-16(8-6-15)19-13-14-20(22(25)21(19)24)17-9-11-18(12-10-17)23(26)27-2/h5-14H,3-4H2,1-2H3
InChIKeyDJRVJEJGNSKXDB-UHFFFAOYSA-N
XLogP6.04
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500366.41
LogP ≤ 56.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate?
The IUPAC name of methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate (CID 142331543) is methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate.
What is the SMILES notation for methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate?
The canonical SMILES for methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate is CCCc1ccc(-c2ccc(-c3ccc(C(=O)OC)cc3)c(F)c2F)cc1.
What is the InChIKey of methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate?
The InChIKey is DJRVJEJGNSKXDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20F2O2/c1-3-4-15-5-7-16(8-6-15)19-13-14-20(22(25)21(19)24)17-9-11-18(12-10-17)23(26)27-2/h5-14H,3-4H2,1-2H3.
What are the key properties of methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate?
methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate has a molecular weight of 366.41 g/mol, XLogP of 6.04, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2,3-difluoro-4-(4-propylphenyl)phenyl]benzoate is sourced from PubChem (CID 142331543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).