C30H23F3O3 — CID 88953481
[2,3-difluoro-4-(4-propylphenyl)phenyl] 4-[3-fluoro-4-(oxiran-2-yl)phenyl]benzoate (PubChem CID 88953481) has the molecular formula C30H23F3O3 and a molecular weight of 488.51 g/mol. Its IUPAC name is [2,3-difluoro-4-(4-propylphenyl)phenyl] 4-[3-fluoro-4-(oxiran-2-yl)phenyl]benzoate.
| Compound Name | [2,3-difluoro-4-(4-propylphenyl)phenyl] 4-[3-fluoro-4-(oxiran-2-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 88953481 |
| Molecular Formula | C30H23F3O3 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | [2,3-difluoro-4-(4-propylphenyl)phenyl] 4-[3-fluoro-4-(oxiran-2-yl)phenyl]benzoate |
| SMILES | CCCc1ccc(-c2ccc(OC(=O)c3ccc(-c4ccc(C5CO5)c(F)c4)cc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C30H23F3O3/c1-2-3-18-4-6-20(7-5-18)23-14-15-26(29(33)28(23)32)36-30(34)21-10-8-19(9-11-21)22-12-13-24(25(31)16-22)27-17-35-27/h4-16,27H,2-3,17H2,1H3 |
| InChIKey | GUCGMDOWKNOWBL-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|