C37H47F3O2 — CID 67732531
2-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2-fluorophenyl]-5-heptyloxane (PubChem CID 67732531) has the molecular formula C37H47F3O2 and a molecular weight of 580.78 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2-fluorophenyl]-5-heptyloxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2-fluorophenyl]-5-heptyloxane |
|---|---|
| PubChem CID | 67732531 |
| Molecular Formula | C37H47F3O2 |
| Molecular Weight | 580.78 g/mol |
| Exact Mass | 580.35 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-heptoxyphenyl)phenyl]-2-fluorophenyl]-5-heptyloxane |
| SMILES | CCCCCCCOc1ccc(-c2ccc(-c3ccc(C4CCC(CCCCCCC)CO4)c(F)c3)cc2)c(F)c1F |
| InChI | InChI=1S/C37H47F3O2/c1-3-5-7-9-11-13-27-14-22-34(42-26-27)32-20-19-30(25-33(32)38)28-15-17-29(18-16-28)31-21-23-35(37(40)36(31)39)41-24-12-10-8-6-4-2/h15-21,23,25,27,34H,3-14,22,24,26H2,1-2H3 |
| InChIKey | WEZRLQIOLLYXNG-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.78 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|