C36H42F4O2 — CID 67732931
5-but-3-enyl-2-[4-[4-(2,3-difluoro-4-nonoxyphenyl)phenyl]-2,3-difluorophenyl]oxane (PubChem CID 67732931) has the molecular formula C36H42F4O2 and a molecular weight of 582.72 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[4-(2,3-difluoro-4-nonoxyphenyl)phenyl]-2,3-difluorophenyl]oxane.
| Compound Name | 5-but-3-enyl-2-[4-[4-(2,3-difluoro-4-nonoxyphenyl)phenyl]-2,3-difluorophenyl]oxane |
|---|---|
| PubChem CID | 67732931 |
| Molecular Formula | C36H42F4O2 |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 5-but-3-enyl-2-[4-[4-(2,3-difluoro-4-nonoxyphenyl)phenyl]-2,3-difluorophenyl]oxane |
| SMILES | C=CCCC1CCC(c2ccc(-c3ccc(-c4ccc(OCCCCCCCCC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C36H42F4O2/c1-3-5-7-8-9-10-11-23-41-32-22-20-29(34(38)36(32)40)27-16-14-26(15-17-27)28-18-19-30(35(39)33(28)37)31-21-13-25(24-42-31)12-6-4-2/h4,14-20,22,25,31H,2-3,5-13,21,23-24H2,1H3 |
| InChIKey | MVAONBHJNCEHCK-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|