C36H43F3O2 — CID 77344041
2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-3-fluorophenyl]-5-pent-3-enyloxane (PubChem CID 77344041) has the molecular formula C36H43F3O2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-3-fluorophenyl]-5-pent-3-enyloxane.
| Compound Name | 2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-3-fluorophenyl]-5-pent-3-enyloxane |
|---|---|
| PubChem CID | 77344041 |
| Molecular Formula | C36H43F3O2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | 2-[4-[4-(2,3-difluoro-4-octoxyphenyl)phenyl]-3-fluorophenyl]-5-pent-3-enyloxane |
| SMILES | CC=CCCC1CCC(c2ccc(-c3ccc(-c4ccc(OCCCCCCCC)c(F)c4F)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C36H43F3O2/c1-3-5-7-8-9-11-23-40-34-22-20-31(35(38)36(34)39)28-16-14-27(15-17-28)30-19-18-29(24-32(30)37)33-21-13-26(25-41-33)12-10-6-4-2/h4,6,14-20,22,24,26,33H,3,5,7-13,21,23,25H2,1-2H3 |
| InChIKey | NVAHLPOJSISRBC-UHFFFAOYSA-N |
| XLogP | 11.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|