C27H26BF3O2 — CID 89045817
CID 89045817 (PubChem CID 89045817) has the molecular formula C27H26BF3O2 and a molecular weight of 450.31 g/mol.
| Compound Name | CID 89045817 |
|---|---|
| PubChem CID | 89045817 |
| Molecular Formula | C27H26BF3O2 |
| Molecular Weight | 450.31 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | — |
| SMILES | [B]COc1ccc(-c2ccc(-c3ccc(C4CCC(CCC)CO4)cc3F)cc2)c(F)c1F |
| InChI | InChI=1S/C27H26BF3O2/c1-2-3-17-4-12-24(32-15-17)20-9-10-21(23(29)14-20)18-5-7-19(8-6-18)22-11-13-25(33-16-28)27(31)26(22)30/h5-11,13-14,17,24H,2-4,12,15-16H2,1H3 |
| InChIKey | VSWYZFQVLMWKPM-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.31 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|