C37H38F2O2 — CID 58021328
2-[4-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]phenyl]phenyl]-5-[(E)-pent-3-enyl]oxane (PubChem CID 58021328) has the molecular formula C37H38F2O2 and a molecular weight of 552.71 g/mol. Its IUPAC name is 2-[4-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]phenyl]phenyl]-5-[(E)-pent-3-enyl]oxane.
| Compound Name | 2-[4-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]phenyl]phenyl]-5-[(E)-pent-3-enyl]oxane |
|---|---|
| PubChem CID | 58021328 |
| Molecular Formula | C37H38F2O2 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 2-[4-[4-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]phenyl]phenyl]-5-[(E)-pent-3-enyl]oxane |
| SMILES | C/C=C/CCC1CCC(c2ccc(-c3ccc(-c4ccc(-c5ccc(OCCC)c(F)c5F)cc4)cc3)cc2)OC1 |
| InChI | InChI=1S/C37H38F2O2/c1-3-5-6-7-26-8-22-34(41-25-26)32-19-15-30(16-20-32)28-11-9-27(10-12-28)29-13-17-31(18-14-29)33-21-23-35(40-24-4-2)37(39)36(33)38/h3,5,9-21,23,26,34H,4,6-8,22,24-25H2,1-2H3/b5-3+ |
| InChIKey | WISXEDMGYGZDPD-HWKANZROSA-N |
| XLogP | 10.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|