C30H38F2O2 — CID 58021190
5-(4-but-3-enylcyclohexyl)-2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]oxane (PubChem CID 58021190) has the molecular formula C30H38F2O2 and a molecular weight of 468.63 g/mol. Its IUPAC name is 5-(4-but-3-enylcyclohexyl)-2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]oxane.
| Compound Name | 5-(4-but-3-enylcyclohexyl)-2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]oxane |
|---|---|
| PubChem CID | 58021190 |
| Molecular Formula | C30H38F2O2 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 5-(4-but-3-enylcyclohexyl)-2-[4-(2,3-difluoro-4-propoxyphenyl)phenyl]oxane |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(-c4ccc(OCCC)c(F)c4F)cc3)OC2)CC1 |
| InChI | InChI=1S/C30H38F2O2/c1-3-5-6-21-7-9-22(10-8-21)25-15-17-27(34-20-25)24-13-11-23(12-14-24)26-16-18-28(33-19-4-2)30(32)29(26)31/h3,11-14,16,18,21-22,25,27H,1,4-10,15,17,19-20H2,2H3 |
| InChIKey | SODKNYQUFPIYNB-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|