C35H40F2O2 — CID 58021175
5-(4-but-3-enylcyclohexyl)-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]phenyl]oxane (PubChem CID 58021175) has the molecular formula C35H40F2O2 and a molecular weight of 530.70 g/mol. Its IUPAC name is 5-(4-but-3-enylcyclohexyl)-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]phenyl]oxane.
| Compound Name | 5-(4-but-3-enylcyclohexyl)-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]phenyl]oxane |
|---|---|
| PubChem CID | 58021175 |
| Molecular Formula | C35H40F2O2 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 5-(4-but-3-enylcyclohexyl)-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]phenyl]oxane |
| SMILES | C=CCCC1CCC(C2CCC(c3ccc(-c4ccc(-c5ccc(OCC)c(F)c5F)cc4)cc3)OC2)CC1 |
| InChI | InChI=1S/C35H40F2O2/c1-3-5-6-24-7-9-27(10-8-24)30-19-21-32(39-23-30)29-17-13-26(14-18-29)25-11-15-28(16-12-25)31-20-22-33(38-4-2)35(37)34(31)36/h3,11-18,20,22,24,27,30,32H,1,4-10,19,21,23H2,2H3 |
| InChIKey | PYMOFCJAWSMWMI-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|