C30H29F3O2 — CID 67732420
5-but-3-enyl-2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-3-fluorophenyl]oxane (PubChem CID 67732420) has the molecular formula C30H29F3O2 and a molecular weight of 478.55 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-3-fluorophenyl]oxane.
| Compound Name | 5-but-3-enyl-2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-3-fluorophenyl]oxane |
|---|---|
| PubChem CID | 67732420 |
| Molecular Formula | C30H29F3O2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | 5-but-3-enyl-2-[4-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)phenyl]-3-fluorophenyl]oxane |
| SMILES | C=CCCC1CCC(c2ccc(-c3ccc(-c4ccc(OCC=C)c(F)c4F)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C30H29F3O2/c1-3-5-6-20-7-15-27(35-19-20)23-12-13-24(26(31)18-23)21-8-10-22(11-9-21)25-14-16-28(34-17-4-2)30(33)29(25)32/h3-4,8-14,16,18,20,27H,1-2,5-7,15,17,19H2 |
| InChIKey | SJJXKUMMKGTHFS-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|