C23H25F3O3 — CID 126764826
2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)-3-fluorophenyl]-5-(ethoxymethyl)oxane (PubChem CID 126764826) has the molecular formula C23H25F3O3 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)-3-fluorophenyl]-5-(ethoxymethyl)oxane.
| Compound Name | 2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)-3-fluorophenyl]-5-(ethoxymethyl)oxane |
|---|---|
| PubChem CID | 126764826 |
| Molecular Formula | C23H25F3O3 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[4-(2,3-difluoro-4-prop-2-enoxyphenyl)-3-fluorophenyl]-5-(ethoxymethyl)oxane |
| SMILES | C=CCOc1ccc(-c2ccc(C3CCC(COCC)CO3)cc2F)c(F)c1F |
| InChI | InChI=1S/C23H25F3O3/c1-3-11-28-21-10-8-18(22(25)23(21)26)17-7-6-16(12-19(17)24)20-9-5-15(14-29-20)13-27-4-2/h3,6-8,10,12,15,20H,1,4-5,9,11,13-14H2,2H3 |
| InChIKey | UHAGXYVSJMGTKR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|