C29H28F4O2 — CID 67733051
5-but-3-enyl-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]oxane (PubChem CID 67733051) has the molecular formula C29H28F4O2 and a molecular weight of 484.53 g/mol. Its IUPAC name is 5-but-3-enyl-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]oxane.
| Compound Name | 5-but-3-enyl-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]oxane |
|---|---|
| PubChem CID | 67733051 |
| Molecular Formula | C29H28F4O2 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 5-but-3-enyl-2-[4-[4-(4-ethoxy-2,3-difluorophenyl)phenyl]-2,3-difluorophenyl]oxane |
| SMILES | C=CCCC1CCC(c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)c(F)c2F)OC1 |
| InChI | InChI=1S/C29H28F4O2/c1-3-5-6-18-7-15-24(35-17-18)23-13-12-21(26(30)28(23)32)19-8-10-20(11-9-19)22-14-16-25(34-4-2)29(33)27(22)31/h3,8-14,16,18,24H,1,4-7,15,17H2,2H3 |
| InChIKey | MTIJBHPBCUKJJI-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|