C31H30F6O2 — CID 58535707
5-but-3-enyl-2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2,3-difluorophenyl]ethyl]oxane (PubChem CID 58535707) has the molecular formula C31H30F6O2 and a molecular weight of 548.57 g/mol. Its IUPAC name is 5-but-3-enyl-2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2,3-difluorophenyl]ethyl]oxane.
| Compound Name | 5-but-3-enyl-2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2,3-difluorophenyl]ethyl]oxane |
|---|---|
| PubChem CID | 58535707 |
| Molecular Formula | C31H30F6O2 |
| Molecular Weight | 548.57 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | 5-but-3-enyl-2-[2-[4-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]-2,3-difluorophenyl]ethyl]oxane |
| SMILES | C=CCCC1CCC(CCc2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)c(F)c2F)OC1 |
| InChI | InChI=1S/C31H30F6O2/c1-3-5-6-18-7-10-20(39-17-18)11-8-19-9-12-21(27(33)26(19)32)22-13-14-23(29(35)28(22)34)24-15-16-25(38-4-2)31(37)30(24)36/h3,9,12-16,18,20H,1,4-8,10-11,17H2,2H3 |
| InChIKey | WLVQNOYAIOIARP-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.57 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|