C29H34F4O2 — CID 58535399
5-ethenyl-2-[4-[2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]ethyl]cyclohexyl]oxane (PubChem CID 58535399) has the molecular formula C29H34F4O2 and a molecular weight of 490.58 g/mol. Its IUPAC name is 5-ethenyl-2-[4-[2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]ethyl]cyclohexyl]oxane.
| Compound Name | 5-ethenyl-2-[4-[2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]ethyl]cyclohexyl]oxane |
|---|---|
| PubChem CID | 58535399 |
| Molecular Formula | C29H34F4O2 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 5-ethenyl-2-[4-[2-[4-(4-ethoxy-2,3-difluorophenyl)-2,3-difluorophenyl]ethyl]cyclohexyl]oxane |
| SMILES | C=CC1CCC(C2CCC(CCc3ccc(-c4ccc(OCC)c(F)c4F)c(F)c3F)CC2)OC1 |
| InChI | InChI=1S/C29H34F4O2/c1-3-18-8-15-24(35-17-18)20-9-5-19(6-10-20)7-11-21-12-13-22(27(31)26(21)30)23-14-16-25(34-4-2)29(33)28(23)32/h3,12-14,16,18-20,24H,1,4-11,15,17H2,2H3 |
| InChIKey | GSVIZGHDGKMOAE-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|