C30H32F2O — CID 154607090
1-[4-[4-[2-(4-ethenylcyclohexyl)ethyl]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 154607090) has the molecular formula C30H32F2O and a molecular weight of 446.58 g/mol. Its IUPAC name is 1-[4-[4-[2-(4-ethenylcyclohexyl)ethyl]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[4-[4-[2-(4-ethenylcyclohexyl)ethyl]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 154607090 |
| Molecular Formula | C30H32F2O |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-[4-[4-[2-(4-ethenylcyclohexyl)ethyl]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | C=CC1CCC(CCc2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H32F2O/c1-3-21-5-7-22(8-6-21)9-10-23-11-13-24(14-12-23)25-15-17-26(18-16-25)27-19-20-28(33-4-2)30(32)29(27)31/h3,11-22H,1,4-10H2,2H3 |
| InChIKey | GHBCFEIXGXWNKS-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|