C25H30F2O — CID 77417109
1-ethoxy-2,3-difluoro-4-[4-[4-(4-methylcyclohexyl)but-3-enyl]phenyl]benzene (PubChem CID 77417109) has the molecular formula C25H30F2O and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[4-(4-methylcyclohexyl)but-3-enyl]phenyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[4-(4-methylcyclohexyl)but-3-enyl]phenyl]benzene |
|---|---|
| PubChem CID | 77417109 |
| Molecular Formula | C25H30F2O |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[4-(4-methylcyclohexyl)but-3-enyl]phenyl]benzene |
| SMILES | CCOc1ccc(-c2ccc(CCC=CC3CCC(C)CC3)cc2)c(F)c1F |
| InChI | InChI=1S/C25H30F2O/c1-3-28-23-17-16-22(24(26)25(23)27)21-14-12-20(13-15-21)7-5-4-6-19-10-8-18(2)9-11-19/h4,6,12-19H,3,5,7-11H2,1-2H3 |
| InChIKey | MULAHRLVEBDHOG-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|