C29H34F2O — CID 77417259
1-ethoxy-2,3-difluoro-4-[4-[4-(4-pent-3-enylcyclohex-3-en-1-yl)but-3-enyl]phenyl]benzene (PubChem CID 77417259) has the molecular formula C29H34F2O and a molecular weight of 436.59 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[4-(4-pent-3-enylcyclohex-3-en-1-yl)but-3-enyl]phenyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[4-(4-pent-3-enylcyclohex-3-en-1-yl)but-3-enyl]phenyl]benzene |
|---|---|
| PubChem CID | 77417259 |
| Molecular Formula | C29H34F2O |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[4-(4-pent-3-enylcyclohex-3-en-1-yl)but-3-enyl]phenyl]benzene |
| SMILES | CC=CCCC1=CCC(C=CCCc2ccc(-c3ccc(OCC)c(F)c3F)cc2)CC1 |
| InChI | InChI=1S/C29H34F2O/c1-3-5-6-9-22-12-14-23(15-13-22)10-7-8-11-24-16-18-25(19-17-24)26-20-21-27(32-4-2)29(31)28(26)30/h3,5,7,10,12,16-21,23H,4,6,8-9,11,13-15H2,1-2H3 |
| InChIKey | DVPZLHDPJJZPKI-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|