C31H32F4O — CID 67730875
1-[4-[2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 67730875) has the molecular formula C31H32F4O and a molecular weight of 496.59 g/mol. Its IUPAC name is 1-[4-[2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[4-[2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 67730875 |
| Molecular Formula | C31H32F4O |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 1-[4-[2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | C/C=C/CCC1CCC(c2ccc(-c3ccc(-c4ccc(OCC)c(F)c4F)cc3)c(F)c2F)CC1 |
| InChI | InChI=1S/C31H32F4O/c1-3-5-6-7-20-8-10-21(11-9-20)24-16-17-25(29(33)28(24)32)22-12-14-23(15-13-22)26-18-19-27(36-4-2)31(35)30(26)34/h3,5,12-21H,4,6-11H2,1-2H3/b5-3+ |
| InChIKey | POZZWHJDVOBVQQ-HWKANZROSA-N |
| XLogP | 9.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|