C32H38F4O — CID 90161638
1-[2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene (PubChem CID 90161638) has the molecular formula C32H38F4O and a molecular weight of 514.65 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene.
| Compound Name | 1-[2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene |
|---|---|
| PubChem CID | 90161638 |
| Molecular Formula | C32H38F4O |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 1-[2,3-difluoro-4-[4-[4-[(E)-pent-3-enyl]cyclohexyl]cyclohexyl]phenyl]-2,3-difluoro-4-[(E)-prop-1-enoxy]benzene |
| SMILES | C/C=C/CCC1CCC(C2CCC(c3ccc(-c4ccc(O/C=C/C)c(F)c4F)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C32H38F4O/c1-3-5-6-7-21-8-10-22(11-9-21)23-12-14-24(15-13-23)25-16-17-26(30(34)29(25)33)27-18-19-28(37-20-4-2)32(36)31(27)35/h3-5,16-24H,6-15H2,1-2H3/b5-3+,20-4+ |
| InChIKey | OXNLTSVOSSUTLW-DINWQBMFSA-N |
| XLogP | 10.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|