C24H34F2O — CID 134358464
2,3-difluoro-1-[(Z)-prop-1-enoxy]-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene (PubChem CID 134358464) has the molecular formula C24H34F2O and a molecular weight of 376.53 g/mol. Its IUPAC name is 2,3-difluoro-1-[(Z)-prop-1-enoxy]-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 2,3-difluoro-1-[(Z)-prop-1-enoxy]-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 134358464 |
| Molecular Formula | C24H34F2O |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 2,3-difluoro-1-[(Z)-prop-1-enoxy]-4-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
| SMILES | C/C=C\Oc1ccc(C2CCC(C3CCC(CCC)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C24H34F2O/c1-3-5-17-6-8-18(9-7-17)19-10-12-20(13-11-19)21-14-15-22(27-16-4-2)24(26)23(21)25/h4,14-20H,3,5-13H2,1-2H3/b16-4- |
| InChIKey | IVSQJFROXLGSEB-XRVIQIRUSA-N |
| XLogP | 7.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|