C26H36F2O — CID 90161515
2,3-difluoro-1-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]-4-[(E)-prop-1-enoxy]benzene (PubChem CID 90161515) has the molecular formula C26H36F2O and a molecular weight of 402.57 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]-4-[(E)-prop-1-enoxy]benzene.
| Compound Name | 2,3-difluoro-1-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]-4-[(E)-prop-1-enoxy]benzene |
|---|---|
| PubChem CID | 90161515 |
| Molecular Formula | C26H36F2O |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 2,3-difluoro-1-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]-4-[(E)-prop-1-enoxy]benzene |
| SMILES | C/C=C/Oc1ccc(C2CCC(C3CCC(/C=C/CCC)CC3)CC2)c(F)c1F |
| InChI | InChI=1S/C26H36F2O/c1-3-5-6-7-19-8-10-20(11-9-19)21-12-14-22(15-13-21)23-16-17-24(29-18-4-2)26(28)25(23)27/h4,6-7,16-22H,3,5,8-15H2,1-2H3/b7-6+,18-4+ |
| InChIKey | XBBWRKCUDLPCPP-OUTJFGBPSA-N |
| XLogP | 8.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|