C25H36F2O — CID 20621688
1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 20621688) has the molecular formula C25H36F2O and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 20621688 |
| Molecular Formula | C25H36F2O |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-pent-1-enyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | CCC/C=C/C1CCC(C2CCC(c3ccc(OCC)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C25H36F2O/c1-3-5-6-7-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-16-17-23(28-4-2)25(27)24(22)26/h6-7,16-21H,3-5,8-15H2,1-2H3/b7-6+ |
| InChIKey | GPJIXWXOENQWGK-VOTSOKGWSA-N |
| XLogP | 7.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|