C31H46F2O — CID 154607351
1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]cyclohexyl]benzene (PubChem CID 154607351) has the molecular formula C31H46F2O and a molecular weight of 472.70 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 154607351 |
| Molecular Formula | C31H46F2O |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.35 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[4-[(E)-2-(4-propylcyclohexyl)ethenyl]cyclohexyl]cyclohexyl]benzene |
| SMILES | CCCC1CCC(/C=C/C2CCC(C3CCC(c4ccc(OCC)c(F)c4F)CC3)CC2)CC1 |
| InChI | InChI=1S/C31H46F2O/c1-3-5-22-6-8-23(9-7-22)10-11-24-12-14-25(15-13-24)26-16-18-27(19-17-26)28-20-21-29(34-4-2)31(33)30(28)32/h10-11,20-27H,3-9,12-19H2,1-2H3/b11-10+ |
| InChIKey | RBENUERDCAIAAH-ZHACJKMWSA-N |
| XLogP | 9.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|