C18H26F2O — CID 53418384
1-(4-butylcyclohexyl)-4-ethoxy-2,3-difluorobenzene (PubChem CID 53418384) has the molecular formula C18H26F2O and a molecular weight of 296.40 g/mol. Its IUPAC name is 1-(4-butylcyclohexyl)-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-(4-butylcyclohexyl)-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 53418384 |
| Molecular Formula | C18H26F2O |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 1-(4-butylcyclohexyl)-4-ethoxy-2,3-difluorobenzene |
| SMILES | CCCCC1CCC(c2ccc(OCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C18H26F2O/c1-3-5-6-13-7-9-14(10-8-13)15-11-12-16(21-4-2)18(20)17(15)19/h11-14H,3-10H2,1-2H3 |
| InChIKey | SPUIKFOOAHSYCG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |