C40H58F4O5P+ — CID 175093052
bis[3-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]propoxy]-oxophosphanium (PubChem CID 175093052) has the molecular formula C40H58F4O5P+ and a molecular weight of 725.86 g/mol. Its IUPAC name is bis[3-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]propoxy]-oxophosphanium.
| Compound Name | bis[3-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]propoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175093052 |
| Molecular Formula | C40H58F4O5P+ |
| Molecular Weight | 725.86 g/mol |
| Exact Mass | 725.40 |
| IUPAC Name | bis[3-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]propoxy]-oxophosphanium |
| SMILES | CCCCCC1CCC(c2ccc(OCCCO[P+](=O)OCCCOc3ccc(C4CCC(CCCCC)CC4)c(F)c3F)c(F)c2F)CC1 |
| InChI | InChI=1S/C40H58F4O5P/c1-3-5-7-11-29-13-17-31(18-14-29)33-21-23-35(39(43)37(33)41)46-25-9-27-48-50(45)49-28-10-26-47-36-24-22-34(38(42)40(36)44)32-19-15-30(16-20-32)12-8-6-4-2/h21-24,29-32H,3-20,25-28H2,1-2H3/q+1 |
| InChIKey | BFWWHTWRCRHEBP-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.86 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|