C50H79F4O4P — CID 176592292
bis[8-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]octyl]phosphinic acid (PubChem CID 176592292) has the molecular formula C50H79F4O4P and a molecular weight of 851.14 g/mol. Its IUPAC name is bis[8-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]octyl]phosphinic acid.
| Compound Name | bis[8-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]octyl]phosphinic acid |
|---|---|
| PubChem CID | 176592292 |
| Molecular Formula | C50H79F4O4P |
| Molecular Weight | 851.14 g/mol |
| Exact Mass | 850.57 |
| IUPAC Name | bis[8-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]octyl]phosphinic acid |
| SMILES | CCCCCC1CCC(c2ccc(OCCCCCCCCP(=O)(O)CCCCCCCCOc3ccc(C4CCC(CCCCC)CC4)c(F)c3F)c(F)c2F)CC1 |
| InChI | InChI=1S/C50H79F4O4P/c1-3-5-15-21-39-23-27-41(28-24-39)43-31-33-45(49(53)47(43)51)57-35-17-11-7-9-13-19-37-59(55,56)38-20-14-10-8-12-18-36-58-46-34-32-44(48(52)50(46)54)42-29-25-40(26-30-42)22-16-6-4-2/h31-34,39-42H,3-30,35-38H2,1-2H3,(H,55,56) |
| InChIKey | RMBZJIJQCVLVMU-UHFFFAOYSA-N |
| XLogP | 16.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.14 |
| LogP ≤ 5 | 16.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|