C27H43F2O4P — CID 139572875
4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]butylphosphonic acid (PubChem CID 139572875) has the molecular formula C27H43F2O4P and a molecular weight of 500.61 g/mol. Its IUPAC name is 4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]butylphosphonic acid.
| Compound Name | 4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]butylphosphonic acid |
|---|---|
| PubChem CID | 139572875 |
| Molecular Formula | C27H43F2O4P |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 4-[2,3-difluoro-4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]butylphosphonic acid |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(OCCCCP(=O)(O)O)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C27H43F2O4P/c1-2-3-4-7-20-8-10-21(11-9-20)22-12-14-23(15-13-22)24-16-17-25(27(29)26(24)28)33-18-5-6-19-34(30,31)32/h16-17,20-23H,2-15,18-19H2,1H3,(H2,30,31,32) |
| InChIKey | ILMRQDGBHMYYOJ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|