C43H65F4O4P — CID 176592309
2-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]ethyl-[7-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]heptyl]phosphinic acid (PubChem CID 176592309) has the molecular formula C43H65F4O4P and a molecular weight of 752.95 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]ethyl-[7-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]heptyl]phosphinic acid.
| Compound Name | 2-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]ethyl-[7-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]heptyl]phosphinic acid |
|---|---|
| PubChem CID | 176592309 |
| Molecular Formula | C43H65F4O4P |
| Molecular Weight | 752.95 g/mol |
| Exact Mass | 752.46 |
| IUPAC Name | 2-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]ethyl-[7-[2,3-difluoro-4-(4-pentylcyclohexyl)phenoxy]heptyl]phosphinic acid |
| SMILES | CCCCCC1CCC(c2ccc(OCCCCCCCP(=O)(O)CCOc3ccc(C4CCC(CCCCC)CC4)c(F)c3F)c(F)c2F)CC1 |
| InChI | InChI=1S/C43H65F4O4P/c1-3-5-10-14-32-16-20-34(21-17-32)36-24-26-38(42(46)40(36)44)50-28-12-8-7-9-13-30-52(48,49)31-29-51-39-27-25-37(41(45)43(39)47)35-22-18-33(19-23-35)15-11-6-4-2/h24-27,32-35H,3-23,28-31H2,1-2H3,(H,48,49) |
| InChIKey | MQBHCCWGWUKTKX-UHFFFAOYSA-N |
| XLogP | 13.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.95 |
| LogP ≤ 5 | 13.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|