C20H32F2NO4P — CID 171500846
4-[4-(4-butylcyclohexyl)-2,3-difluorophenoxy]butyl-N-hydroxyphosphonamidic acid (PubChem CID 171500846) has the molecular formula C20H32F2NO4P and a molecular weight of 419.45 g/mol. Its IUPAC name is 4-[4-(4-butylcyclohexyl)-2,3-difluorophenoxy]butyl-N-hydroxyphosphonamidic acid.
| Compound Name | 4-[4-(4-butylcyclohexyl)-2,3-difluorophenoxy]butyl-N-hydroxyphosphonamidic acid |
|---|---|
| PubChem CID | 171500846 |
| Molecular Formula | C20H32F2NO4P |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 4-[4-(4-butylcyclohexyl)-2,3-difluorophenoxy]butyl-N-hydroxyphosphonamidic acid |
| SMILES | CCCCC1CCC(c2ccc(OCCCCP(=O)(O)NO)c(F)c2F)CC1 |
| InChI | InChI=1S/C20H32F2NO4P/c1-2-3-6-15-7-9-16(10-8-15)17-11-12-18(20(22)19(17)21)27-13-4-5-14-28(25,26)23-24/h11-12,15-16,24H,2-10,13-14H2,1H3,(H2,23,25,26) |
| InChIKey | URFHJIVWYTYLHK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|