C19H26F4O — CID 162516345
1-(2,2-difluoroethoxy)-2,3-difluoro-4-(4-pentylcyclohexyl)benzene (PubChem CID 162516345) has the molecular formula C19H26F4O and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-2,3-difluoro-4-(4-pentylcyclohexyl)benzene.
| Compound Name | 1-(2,2-difluoroethoxy)-2,3-difluoro-4-(4-pentylcyclohexyl)benzene |
|---|---|
| PubChem CID | 162516345 |
| Molecular Formula | C19H26F4O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-2,3-difluoro-4-(4-pentylcyclohexyl)benzene |
| SMILES | CCCCCC1CCC(c2ccc(OCC(F)F)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H26F4O/c1-2-3-4-5-13-6-8-14(9-7-13)15-10-11-16(19(23)18(15)22)24-12-17(20)21/h10-11,13-14,17H,2-9,12H2,1H3 |
| InChIKey | CBZODKHNJWBTSG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|