C38H54F4O2 — CID 160550252
1-ethoxy-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]benzene;1-ethoxy-2,3-difluoro-4-(4-pentylcyclohexyl)benzene (PubChem CID 160550252) has the molecular formula C38H54F4O2 and a molecular weight of 618.84 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]benzene;1-ethoxy-2,3-difluoro-4-(4-pentylcyclohexyl)benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]benzene;1-ethoxy-2,3-difluoro-4-(4-pentylcyclohexyl)benzene |
|---|---|
| PubChem CID | 160550252 |
| Molecular Formula | C38H54F4O2 |
| Molecular Weight | 618.84 g/mol |
| Exact Mass | 618.41 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[4-[(E)-pent-3-enyl]cyclohexyl]benzene;1-ethoxy-2,3-difluoro-4-(4-pentylcyclohexyl)benzene |
| SMILES | C/C=C/CCC1CCC(c2ccc(OCC)c(F)c2F)CC1.CCCCCC1CCC(c2ccc(OCC)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H28F2O.C19H26F2O/c2*1-3-5-6-7-14-8-10-15(11-9-14)16-12-13-17(22-4-2)19(21)18(16)20/h12-15H,3-11H2,1-2H3;3,5,12-15H,4,6-11H2,1-2H3/b;5-3+ |
| InChIKey | QXYVOZOEOJMEIC-GWDXERMASA-N |
| XLogP | 12.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.84 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|