C26H38F2O2 — CID 20816615
1-ethoxy-2,3-difluoro-4-[(E)-3-[4-(4-propylcyclohexyl)cyclohexyl]prop-2-enoxy]benzene (PubChem CID 20816615) has the molecular formula C26H38F2O2 and a molecular weight of 420.58 g/mol. Its IUPAC name is 1-ethoxy-2,3-difluoro-4-[(E)-3-[4-(4-propylcyclohexyl)cyclohexyl]prop-2-enoxy]benzene.
| Compound Name | 1-ethoxy-2,3-difluoro-4-[(E)-3-[4-(4-propylcyclohexyl)cyclohexyl]prop-2-enoxy]benzene |
|---|---|
| PubChem CID | 20816615 |
| Molecular Formula | C26H38F2O2 |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1-ethoxy-2,3-difluoro-4-[(E)-3-[4-(4-propylcyclohexyl)cyclohexyl]prop-2-enoxy]benzene |
| SMILES | CCCC1CCC(C2CCC(/C=C/COc3ccc(OCC)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C26H38F2O2/c1-3-6-19-8-12-21(13-9-19)22-14-10-20(11-15-22)7-5-18-30-24-17-16-23(29-4-2)25(27)26(24)28/h5,7,16-17,19-22H,3-4,6,8-15,18H2,1-2H3/b7-5+ |
| InChIKey | MXLHYHBKBIRYDS-FNORWQNLSA-N |
| XLogP | 7.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|