C27H40F2O2 — CID 67863508
2,3-difluoro-1-methoxy-4-[(E)-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-2-enoxy]benzene (PubChem CID 67863508) has the molecular formula C27H40F2O2 and a molecular weight of 434.61 g/mol. Its IUPAC name is 2,3-difluoro-1-methoxy-4-[(E)-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-2-enoxy]benzene.
| Compound Name | 2,3-difluoro-1-methoxy-4-[(E)-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-2-enoxy]benzene |
|---|---|
| PubChem CID | 67863508 |
| Molecular Formula | C27H40F2O2 |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 2,3-difluoro-1-methoxy-4-[(E)-3-[4-(4-pentylcyclohexyl)cyclohexyl]prop-2-enoxy]benzene |
| SMILES | CCCCCC1CCC(C2CCC(/C=C/COc3ccc(OC)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C27H40F2O2/c1-3-4-5-7-20-9-13-22(14-10-20)23-15-11-21(12-16-23)8-6-19-31-25-18-17-24(30-2)26(28)27(25)29/h6,8,17-18,20-23H,3-5,7,9-16,19H2,1-2H3/b8-6+ |
| InChIKey | HTKVOSGHRHMYDC-SOFGYWHQSA-N |
| XLogP | 8.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|