C19H24F2O2 — CID 153282281
1-[(E)-3-cyclopentylprop-2-enoxy]-4-(2-cyclopropylethoxy)-2,3-difluorobenzene (PubChem CID 153282281) has the molecular formula C19H24F2O2 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1-[(E)-3-cyclopentylprop-2-enoxy]-4-(2-cyclopropylethoxy)-2,3-difluorobenzene.
| Compound Name | 1-[(E)-3-cyclopentylprop-2-enoxy]-4-(2-cyclopropylethoxy)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 153282281 |
| Molecular Formula | C19H24F2O2 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-[(E)-3-cyclopentylprop-2-enoxy]-4-(2-cyclopropylethoxy)-2,3-difluorobenzene |
| SMILES | Fc1c(OC/C=C/C2CCCC2)ccc(OCCC2CC2)c1F |
| InChI | InChI=1S/C19H24F2O2/c20-18-16(22-12-3-6-14-4-1-2-5-14)9-10-17(19(18)21)23-13-11-15-7-8-15/h3,6,9-10,14-15H,1-2,4-5,7-8,11-13H2/b6-3+ |
| InChIKey | CLNTXPFOQZNDEM-ZZXKWVIFSA-N |
| XLogP | 5.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|