C18H23FO — CID 159641659
1-(2-cyclopropylethoxy)-4-[(E)-3-cyclopropylprop-2-enyl]-2-fluoro-3-methylbenzene (PubChem CID 159641659) has the molecular formula C18H23FO and a molecular weight of 274.38 g/mol. Its IUPAC name is 1-(2-cyclopropylethoxy)-4-[(E)-3-cyclopropylprop-2-enyl]-2-fluoro-3-methylbenzene.
| Compound Name | 1-(2-cyclopropylethoxy)-4-[(E)-3-cyclopropylprop-2-enyl]-2-fluoro-3-methylbenzene |
|---|---|
| PubChem CID | 159641659 |
| Molecular Formula | C18H23FO |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(2-cyclopropylethoxy)-4-[(E)-3-cyclopropylprop-2-enyl]-2-fluoro-3-methylbenzene |
| SMILES | Cc1c(C/C=C/C2CC2)ccc(OCCC2CC2)c1F |
| InChI | InChI=1S/C18H23FO/c1-13-16(4-2-3-14-5-6-14)9-10-17(18(13)19)20-12-11-15-7-8-15/h2-3,9-10,14-15H,4-8,11-12H2,1H3/b3-2+ |
| InChIKey | KYOZOWRGBCJSLD-NSCUHMNNSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|