C20H25F3O2 — CID 161037979
1-(cyclobutylmethoxy)-4-[(E)-3-cyclobutylprop-2-enyl]-3-methyl-2-(trifluoromethoxy)benzene (PubChem CID 161037979) has the molecular formula C20H25F3O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(cyclobutylmethoxy)-4-[(E)-3-cyclobutylprop-2-enyl]-3-methyl-2-(trifluoromethoxy)benzene.
| Compound Name | 1-(cyclobutylmethoxy)-4-[(E)-3-cyclobutylprop-2-enyl]-3-methyl-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 161037979 |
| Molecular Formula | C20H25F3O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 1-(cyclobutylmethoxy)-4-[(E)-3-cyclobutylprop-2-enyl]-3-methyl-2-(trifluoromethoxy)benzene |
| SMILES | Cc1c(C/C=C/C2CCC2)ccc(OCC2CCC2)c1OC(F)(F)F |
| InChI | InChI=1S/C20H25F3O2/c1-14-17(10-4-7-15-5-2-6-15)11-12-18(19(14)25-20(21,22)23)24-13-16-8-3-9-16/h4,7,11-12,15-16H,2-3,5-6,8-10,13H2,1H3/b7-4+ |
| InChIKey | BSLGJXFTUQMVHI-QPJJXVBHSA-N |
| XLogP | 5.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|