C20H26F2O — CID 153282642
1-(cyclobutylmethoxy)-4-[(E)-4-cyclopentylbut-3-enyl]-2,3-difluorobenzene (PubChem CID 153282642) has the molecular formula C20H26F2O and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-(cyclobutylmethoxy)-4-[(E)-4-cyclopentylbut-3-enyl]-2,3-difluorobenzene.
| Compound Name | 1-(cyclobutylmethoxy)-4-[(E)-4-cyclopentylbut-3-enyl]-2,3-difluorobenzene |
|---|---|
| PubChem CID | 153282642 |
| Molecular Formula | C20H26F2O |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-(cyclobutylmethoxy)-4-[(E)-4-cyclopentylbut-3-enyl]-2,3-difluorobenzene |
| SMILES | Fc1c(CC/C=C/C2CCCC2)ccc(OCC2CCC2)c1F |
| InChI | InChI=1S/C20H26F2O/c21-19-17(11-4-3-8-15-6-1-2-7-15)12-13-18(20(19)22)23-14-16-9-5-10-16/h3,8,12-13,15-16H,1-2,4-7,9-11,14H2/b8-3+ |
| InChIKey | ISPBYZFOOGDVAT-FPYGCLRLSA-N |
| XLogP | 5.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|