C27H32F4O — CID 118886065
1-[2,3-difluoro-4-[(E)-4-(4-propylcyclohexyl)but-3-enyl]phenyl]-4-ethoxy-2,3-difluorobenzene (PubChem CID 118886065) has the molecular formula C27H32F4O and a molecular weight of 448.54 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[(E)-4-(4-propylcyclohexyl)but-3-enyl]phenyl]-4-ethoxy-2,3-difluorobenzene.
| Compound Name | 1-[2,3-difluoro-4-[(E)-4-(4-propylcyclohexyl)but-3-enyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 118886065 |
| Molecular Formula | C27H32F4O |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-[2,3-difluoro-4-[(E)-4-(4-propylcyclohexyl)but-3-enyl]phenyl]-4-ethoxy-2,3-difluorobenzene |
| SMILES | CCCC1CCC(/C=C/CCc2ccc(-c3ccc(OCC)c(F)c3F)c(F)c2F)CC1 |
| InChI | InChI=1S/C27H32F4O/c1-3-7-18-10-12-19(13-11-18)8-5-6-9-20-14-15-21(25(29)24(20)28)22-16-17-23(32-4-2)27(31)26(22)30/h5,8,14-19H,3-4,6-7,9-13H2,1-2H3/b8-5+ |
| InChIKey | DNYUZUGCQAVWJU-VMPITWQZSA-N |
| XLogP | 8.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|